C21H22N4O6S — CID 32862416
4-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 32862416) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is 4-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 32862416 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(SCC(=O)NCc2ccc(C(=O)N3CCOCC3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22N4O6S/c22-20(27)16-5-6-18(17(11-16)25(29)30)32-13-19(26)23-12-14-1-3-15(4-2-14)21(28)24-7-9-31-10-8-24/h1-6,11H,7-10,12-13H2,(H2,22,27)(H,23,26) |
| InChIKey | ARNSUBPRDPRMEO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|