C21H22BrClN4O4S — CID 3289549
4-[2-[[2-(4-bromo-2-chlorophenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 3289549) has the molecular formula C21H22BrClN4O4S and a molecular weight of 541.86 g/mol. Its IUPAC name is 4-[2-[[2-(4-bromo-2-chlorophenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[[2-(4-bromo-2-chlorophenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 3289549 |
| Molecular Formula | C21H22BrClN4O4S |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 4-[2-[[2-(4-bromo-2-chlorophenoxy)acetyl]carbamothioyl]hydrazinyl]-N-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCC(=O)NNC(=S)NC(=O)COc2ccc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C21H22BrClN4O4S/c1-12-3-4-13(2)16(9-12)24-18(28)7-8-19(29)26-27-21(32)25-20(30)11-31-17-6-5-14(22)10-15(17)23/h3-6,9-10H,7-8,11H2,1-2H3,(H,24,28)(H,26,29)(H2,25,27,30,32) |
| InChIKey | IWWHQUDEQOTXQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|