C28H23ClN6O4 — CID 3291223
3-[1-[3-(2-chlorophenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 3291223) has the molecular formula C28H23ClN6O4 and a molecular weight of 542.98 g/mol. Its IUPAC name is 3-[1-[3-(2-chlorophenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[3-(2-chlorophenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 3291223 |
| Molecular Formula | C28H23ClN6O4 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 3-[1-[3-(2-chlorophenyl)-1-(3-nitrophenyl)pyrazole-5-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=C(c1cc(-c2ccccc2Cl)nn1-c1cccc([N+](=O)[O-])c1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C28H23ClN6O4/c29-22-9-2-1-8-21(22)24-17-26(34(31-24)19-6-5-7-20(16-19)35(38)39)27(36)32-14-12-18(13-15-32)33-25-11-4-3-10-23(25)30-28(33)37/h1-11,16-18H,12-15H2,(H,30,37) |
| InChIKey | QPWVJYYRVAHHCS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|