C17H14BrN3O2S — CID 3291333
2-(2-bromo-4-methylphenoxy)-N-[(3-cyanophenyl)carbamothioyl]acetamide (PubChem CID 3291333) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(3-cyanophenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(3-cyanophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3291333 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(3-cyanophenyl)carbamothioyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)Nc2cccc(C#N)c2)c(Br)c1 |
| InChI | InChI=1S/C17H14BrN3O2S/c1-11-5-6-15(14(18)7-11)23-10-16(22)21-17(24)20-13-4-2-3-12(8-13)9-19/h2-8H,10H2,1H3,(H2,20,21,22,24) |
| InChIKey | VYYPVCHKJYNPHN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|