C14H22N4O — CID 3301323
4-(1-methylpiperidin-2-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one (PubChem CID 3301323) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-(1-methylpiperidin-2-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one.
| Compound Name | 4-(1-methylpiperidin-2-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
|---|---|
| PubChem CID | 3301323 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-(1-methylpiperidin-2-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
| SMILES | CN1CCCCC1c1[nH]c(=O)nc2c1CCCCN2 |
| InChI | InChI=1S/C14H22N4O/c1-18-9-5-3-7-11(18)12-10-6-2-4-8-15-13(10)17-14(19)16-12/h11H,2-9H2,1H3,(H2,15,16,17,19) |
| InChIKey | JAOZZDNKZDHWLI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |