C17H19N3O4 — CID 33101063
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[3-(methoxymethyl)phenyl]prop-2-enamide (PubChem CID 33101063) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[3-(methoxymethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[3-(methoxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 33101063 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-[3-(methoxymethyl)phenyl]prop-2-enamide |
| SMILES | COCc1cccc(NC(=O)/C=C/c2cn(C)c(=O)n(C)c2=O)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-19-10-13(16(22)20(2)17(19)23)7-8-15(21)18-14-6-4-5-12(9-14)11-24-3/h4-10H,11H2,1-3H3,(H,18,21)/b8-7+ |
| InChIKey | GHRLMZCKBLTJAH-BQYQJAHWSA-N |
| XLogP | 0.88 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|