C18H21F3N4O2S — CID 3310571
5-[2-(diethylamino)ethyliminomethyl]-6-hydroxy-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-one (PubChem CID 3310571) has the molecular formula C18H21F3N4O2S and a molecular weight of 414.45 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyliminomethyl]-6-hydroxy-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-one.
| Compound Name | 5-[2-(diethylamino)ethyliminomethyl]-6-hydroxy-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 3310571 |
| Molecular Formula | C18H21F3N4O2S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-[2-(diethylamino)ethyliminomethyl]-6-hydroxy-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]pyrimidin-4-one |
| SMILES | CCN(CC)CC/N=C/c1c(O)n(-c2cccc(C(F)(F)F)c2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C18H21F3N4O2S/c1-3-24(4-2)9-8-22-11-14-15(26)23-17(28)25(16(14)27)13-7-5-6-12(10-13)18(19,20)21/h5-7,10-11,27H,3-4,8-9H2,1-2H3,(H,23,26,28)/b22-11+ |
| InChIKey | YXRKLOXYVMNEMB-SSDVNMTOSA-N |
| XLogP | 3.38 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|