C15H10F2N2O4S — CID 33147004
[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2,4-difluorobenzenesulfonate (PubChem CID 33147004) has the molecular formula C15H10F2N2O4S and a molecular weight of 352.32 g/mol. Its IUPAC name is [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2,4-difluorobenzenesulfonate.
| Compound Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2,4-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 33147004 |
| Molecular Formula | C15H10F2N2O4S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2,4-difluorobenzenesulfonate |
| SMILES | Cc1nc(-c2ccc(OS(=O)(=O)c3ccc(F)cc3F)cc2)no1 |
| InChI | InChI=1S/C15H10F2N2O4S/c1-9-18-15(19-22-9)10-2-5-12(6-3-10)23-24(20,21)14-7-4-11(16)8-13(14)17/h2-8H,1H3 |
| InChIKey | PYSLTSOBTMESNT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|