C16H13FN2O4S — CID 39623861
[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2-fluoro-5-methylbenzenesulfonate (PubChem CID 39623861) has the molecular formula C16H13FN2O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2-fluoro-5-methylbenzenesulfonate.
| Compound Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2-fluoro-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 39623861 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl] 2-fluoro-5-methylbenzenesulfonate |
| SMILES | Cc1ccc(F)c(S(=O)(=O)Oc2ccc(-c3noc(C)n3)cc2)c1 |
| InChI | InChI=1S/C16H13FN2O4S/c1-10-3-8-14(17)15(9-10)24(20,21)23-13-6-4-12(5-7-13)16-18-11(2)22-19-16/h3-9H,1-2H3 |
| InChIKey | LCMOHLLHOCVQIQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|