C20H22ClNO3 — CID 3315403
1-[(4-chlorophenyl)-(4-ethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3315403) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(4-ethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)-(4-ethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3315403 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[(4-chlorophenyl)-(4-ethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccc(Cl)cc2)N2CCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C20H22ClNO3/c1-2-25-17-11-7-15(8-12-17)19(14-5-9-16(21)10-6-14)22-13-3-4-18(22)20(23)24/h5-12,18-19H,2-4,13H2,1H3,(H,23,24) |
| InChIKey | PLYNBPYRFRXZMB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |