C18H21N3OS — CID 3316017
2-[4-(dimethylamino)phenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazinan-4-one (PubChem CID 3316017) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazinan-4-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3316017 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-3-(pyridin-3-ylmethyl)-1,3-thiazinan-4-one |
| SMILES | CN(C)c1ccc(C2SCCC(=O)N2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C18H21N3OS/c1-20(2)16-7-5-15(6-8-16)18-21(17(22)9-11-23-18)13-14-4-3-10-19-12-14/h3-8,10,12,18H,9,11,13H2,1-2H3 |
| InChIKey | NJZBOEHNYZJVEQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|