C21H26ClN3O3S2 — CID 33177662
N-[(5-chlorothiophen-2-yl)methyl]-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 33177662) has the molecular formula C21H26ClN3O3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 33177662 |
| Molecular Formula | C21H26ClN3O3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H26ClN3O3S2/c22-20-9-6-16(29-20)15-23-21(26)18-14-17(7-8-19(18)24-10-4-5-11-24)30(27,28)25-12-2-1-3-13-25/h6-9,14H,1-5,10-13,15H2,(H,23,26) |
| InChIKey | GJXPDQBVWNLLPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |