C19H21N3O8S — CID 3319965
diethyl 3-methyl-5-[[2-[(6-methyl-2-nitro-3-pyridinyl)oxy]acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 3319965) has the molecular formula C19H21N3O8S and a molecular weight of 451.46 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-[(6-methyl-2-nitro-3-pyridinyl)oxy]acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-[(6-methyl-2-nitro-3-pyridinyl)oxy]acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3319965 |
| Molecular Formula | C19H21N3O8S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | diethyl 3-methyl-5-[[2-[(6-methyl-2-nitro-3-pyridinyl)oxy]acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COc2ccc(C)nc2[N+](=O)[O-])c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H21N3O8S/c1-5-28-18(24)14-11(4)15(19(25)29-6-2)31-17(14)21-13(23)9-30-12-8-7-10(3)20-16(12)22(26)27/h7-8H,5-6,9H2,1-4H3,(H,21,23) |
| InChIKey | MEISUFYFWFUSPT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|