C16H19ClN2O3 — CID 3324139
1-(4-chlorophenoxy)-3-[(6-methoxy-2-pyridinyl)-methylamino]propan-2-ol (PubChem CID 3324139) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[(6-methoxy-2-pyridinyl)-methylamino]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[(6-methoxy-2-pyridinyl)-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 3324139 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[(6-methoxy-2-pyridinyl)-methylamino]propan-2-ol |
| SMILES | COc1cccc(N(C)CC(O)COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-19(15-4-3-5-16(18-15)21-2)10-13(20)11-22-14-8-6-12(17)7-9-14/h3-9,13,20H,10-11H2,1-2H3 |
| InChIKey | FFDDSSFIIWRTMM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |