C19H13ClFN3O2S — CID 3327505
2-[5-[(2-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide (PubChem CID 3327505) has the molecular formula C19H13ClFN3O2S and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide.
| Compound Name | 2-[5-[(2-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 3327505 |
| Molecular Formula | C19H13ClFN3O2S |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-[5-[(2-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetamide |
| SMILES | N#CC(C(N)=O)=C1SC(Cc2ccccc2Cl)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13ClFN3O2S/c20-15-4-2-1-3-11(15)9-16-18(26)24(13-7-5-12(21)6-8-13)19(27-16)14(10-22)17(23)25/h1-8,16H,9H2,(H2,23,25) |
| InChIKey | LDMGLVCJZSBNQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|