C19H20N2O6 — CID 33278355
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 33278355) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 33278355 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)c1cc(OC)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O6/c1-3-20-19(25)21-17(23)16(12-7-5-4-6-8-12)27-18(24)14-11-13(26-2)9-10-15(14)22/h4-11,16,22H,3H2,1-2H3,(H2,20,21,23,25)/t16-/m1/s1 |
| InChIKey | WMKGHSGFKAZHBQ-MRXNPFEDSA-N |
| XLogP | 2.14 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |