C20H21N3O4S — CID 3327926
1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea (PubChem CID 3327926) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 3327926 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea |
| SMILES | COc1ccc(C2=NOC(CNC(=S)NCc3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-24-15-5-3-14(4-6-15)17-9-16(27-23-17)11-22-20(28)21-10-13-2-7-18-19(8-13)26-12-25-18/h2-8,16H,9-12H2,1H3,(H2,21,22,28) |
| InChIKey | LHCKWHJYBJCQDU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|