C15H23N3O5S — CID 33321412
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate (PubChem CID 33321412) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 33321412 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)N2CCC(C)CC2)n(C)c1 |
| InChI | InChI=1S/C15H23N3O5S/c1-11-4-6-18(7-5-11)14(19)10-23-15(20)13-8-12(9-17(13)3)24(21,22)16-2/h8-9,11,16H,4-7,10H2,1-3H3 |
| InChIKey | QNDYELSDTZGUBV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |