C21H17N3OS — CID 3340967
6-benzylsulfanyl-4-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3,5-dicarbonitrile (PubChem CID 3340967) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is 6-benzylsulfanyl-4-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 6-benzylsulfanyl-4-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 3340967 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 6-benzylsulfanyl-4-(2-methylphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3,5-dicarbonitrile |
| SMILES | Cc1ccccc1C1C(C#N)=C(SCc2ccccc2)NC(=O)C1C#N |
| InChI | InChI=1S/C21H17N3OS/c1-14-7-5-6-10-16(14)19-17(11-22)20(25)24-21(18(19)12-23)26-13-15-8-3-2-4-9-15/h2-10,17,19H,13H2,1H3,(H,24,25) |
| InChIKey | NBCDHRJSGGKJIB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_E(4)', 'substructure': 'N/A'} |
|---|