C17H23ClN2O2S — CID 3349548
N-[3-(3-chloro-4-methylphenyl)sulfanyl-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide (PubChem CID 3349548) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is N-[3-(3-chloro-4-methylphenyl)sulfanyl-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide.
| Compound Name | N-[3-(3-chloro-4-methylphenyl)sulfanyl-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 3349548 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[3-(3-chloro-4-methylphenyl)sulfanyl-1-oxo-1-piperidin-1-ylpropan-2-yl]acetamide |
| SMILES | CC(=O)NC(CSc1ccc(C)c(Cl)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O2S/c1-12-6-7-14(10-15(12)18)23-11-16(19-13(2)21)17(22)20-8-4-3-5-9-20/h6-7,10,16H,3-5,8-9,11H2,1-2H3,(H,19,21) |
| InChIKey | OQEZCUMDICHNRG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |