C37H47NO9 — CID 3360595
[1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17-hydroxy-2-methoxy-6-(3-methylphenyl)-1,4,7-trioxoheptadec-5-en-3-yl] acetate (PubChem CID 3360595) has the molecular formula C37H47NO9 and a molecular weight of 649.78 g/mol. Its IUPAC name is [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17-hydroxy-2-methoxy-6-(3-methylphenyl)-1,4,7-trioxoheptadec-5-en-3-yl] acetate.
| Compound Name | [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17-hydroxy-2-methoxy-6-(3-methylphenyl)-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 3360595 |
| Molecular Formula | C37H47NO9 |
| Molecular Weight | 649.78 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17-hydroxy-2-methoxy-6-(3-methylphenyl)-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
| SMILES | COC(C(=O)N1C(=O)OCC1Cc1ccccc1)C(OC(C)=O)C(=O)C=C(C(=O)CCCCCCCCCCO)c1cccc(C)c1 |
| InChI | InChI=1S/C37H47NO9/c1-26-16-15-19-29(22-26)31(32(41)20-13-8-6-4-5-7-9-14-21-39)24-33(42)34(47-27(2)40)35(45-3)36(43)38-30(25-46-37(38)44)23-28-17-11-10-12-18-28/h10-12,15-19,22,24,30,34-35,39H,4-9,13-14,20-21,23,25H2,1-3H3 |
| InChIKey | PKAKKRAUNWSGOA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|