C34H41NO10 — CID 5056546
[1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-10-[2-(2-hydroxyethoxy)ethoxy]-2-methyl-6-(3-methylphenyl)-1,4,7-trioxodec-5-en-3-yl] acetate (PubChem CID 5056546) has the molecular formula C34H41NO10 and a molecular weight of 623.70 g/mol. Its IUPAC name is [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-10-[2-(2-hydroxyethoxy)ethoxy]-2-methyl-6-(3-methylphenyl)-1,4,7-trioxodec-5-en-3-yl] acetate.
| Compound Name | [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-10-[2-(2-hydroxyethoxy)ethoxy]-2-methyl-6-(3-methylphenyl)-1,4,7-trioxodec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 5056546 |
| Molecular Formula | C34H41NO10 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | [1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-10-[2-(2-hydroxyethoxy)ethoxy]-2-methyl-6-(3-methylphenyl)-1,4,7-trioxodec-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)C=C(C(=O)CCCOCCOCCO)c1cccc(C)c1)C(C)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C34H41NO10/c1-23-9-7-12-27(19-23)29(30(38)13-8-15-42-17-18-43-16-14-36)21-31(39)32(45-25(3)37)24(2)33(40)35-28(22-44-34(35)41)20-26-10-5-4-6-11-26/h4-7,9-12,19,21,24,28,32,36H,8,13-18,20,22H2,1-3H3 |
| InChIKey | HPMWOONFLVBYBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|