C33H39NO8 — CID 6709396
[(2S,3S)-2-benzyl-11-hydroxy-6-(3-methylphenyl)-1,4,7-trioxo-1-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]undec-5-en-3-yl] acetate (PubChem CID 6709396) has the molecular formula C33H39NO8 and a molecular weight of 577.67 g/mol. Its IUPAC name is [(2S,3S)-2-benzyl-11-hydroxy-6-(3-methylphenyl)-1,4,7-trioxo-1-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]undec-5-en-3-yl] acetate.
| Compound Name | [(2S,3S)-2-benzyl-11-hydroxy-6-(3-methylphenyl)-1,4,7-trioxo-1-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]undec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 6709396 |
| Molecular Formula | C33H39NO8 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | [(2S,3S)-2-benzyl-11-hydroxy-6-(3-methylphenyl)-1,4,7-trioxo-1-[(4S)-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]undec-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)C=C(C(=O)CCCCO)c1cccc(C)c1)[C@H](Cc1ccccc1)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C33H39NO8/c1-21(2)28-20-41-33(40)34(28)32(39)27(18-24-12-6-5-7-13-24)31(42-23(4)36)30(38)19-26(29(37)15-8-9-16-35)25-14-10-11-22(3)17-25/h5-7,10-14,17,19,21,27-28,31,35H,8-9,15-16,18,20H2,1-4H3/t27-,28+,31-/m0/s1 |
| InChIKey | DQWAZZSTJFLVHK-QXIHQKPUSA-N |
| XLogP | 4.47 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|