C31H35NO8 — CID 6668045
[(2S,3S)-2-benzyl-13-hydroxy-1,4,7-trioxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]tridec-5-en-3-yl] acetate (PubChem CID 6668045) has the molecular formula C31H35NO8 and a molecular weight of 549.62 g/mol. Its IUPAC name is [(2S,3S)-2-benzyl-13-hydroxy-1,4,7-trioxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]tridec-5-en-3-yl] acetate.
| Compound Name | [(2S,3S)-2-benzyl-13-hydroxy-1,4,7-trioxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]tridec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 6668045 |
| Molecular Formula | C31H35NO8 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | [(2S,3S)-2-benzyl-13-hydroxy-1,4,7-trioxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]tridec-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)C=CC(=O)CCCCCCO)[C@H](Cc1ccccc1)C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H35NO8/c1-22(34)40-29(28(36)18-17-25(35)16-10-2-3-11-19-33)26(20-23-12-6-4-7-13-23)30(37)32-27(21-39-31(32)38)24-14-8-5-9-15-24/h4-9,12-15,17-18,26-27,29,33H,2-3,10-11,16,19-21H2,1H3/t26-,27+,29-/m0/s1 |
| InChIKey | PQRSOUZCNSGYMS-GKRYNVPLSA-N |
| XLogP | 4.13 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|