C34H49NO8 — CID 3333316
[2-benzyl-1-(5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)-17-hydroxy-1,4,7-trioxoheptadec-5-en-3-yl] acetate (PubChem CID 3333316) has the molecular formula C34H49NO8 and a molecular weight of 599.77 g/mol. Its IUPAC name is [2-benzyl-1-(5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)-17-hydroxy-1,4,7-trioxoheptadec-5-en-3-yl] acetate.
| Compound Name | [2-benzyl-1-(5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)-17-hydroxy-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 3333316 |
| Molecular Formula | C34H49NO8 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | [2-benzyl-1-(5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)-17-hydroxy-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)C=CC(=O)CCCCCCCCCCO)C(Cc1ccccc1)C(=O)N1C(=O)OC(C)(C)C1C(C)C |
| InChI | InChI=1S/C34H49NO8/c1-24(2)31-34(4,5)43-33(41)35(31)32(40)28(23-26-17-13-12-14-18-26)30(42-25(3)37)29(39)21-20-27(38)19-15-10-8-6-7-9-11-16-22-36/h12-14,17-18,20-21,24,28,30-31,36H,6-11,15-16,19,22-23H2,1-5H3 |
| InChIKey | CPFPUPPOXLDNOW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|