C25H31NO8 — CID 5084855
[13-hydroxy-2-methyl-1,4,7-trioxo-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)tridec-5-en-3-yl] acetate (PubChem CID 5084855) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is [13-hydroxy-2-methyl-1,4,7-trioxo-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)tridec-5-en-3-yl] acetate.
| Compound Name | [13-hydroxy-2-methyl-1,4,7-trioxo-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)tridec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 5084855 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [13-hydroxy-2-methyl-1,4,7-trioxo-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)tridec-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)C=CC(=O)CCCCCCO)C(C)C(=O)N1C(=O)OCC1c1ccccc1 |
| InChI | InChI=1S/C25H31NO8/c1-17(24(31)26-21(16-33-25(26)32)19-10-6-5-7-11-19)23(34-18(2)28)22(30)14-13-20(29)12-8-3-4-9-15-27/h5-7,10-11,13-14,17,21,23,27H,3-4,8-9,12,15-16H2,1-2H3 |
| InChIKey | SGOHUHKXQHXVIA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|