C24H29NO8 — CID 6709219
[(2R,3R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-11-hydroxy-2-methyl-1,4,7-trioxoundec-5-en-3-yl] acetate (PubChem CID 6709219) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(2R,3R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-11-hydroxy-2-methyl-1,4,7-trioxoundec-5-en-3-yl] acetate.
| Compound Name | [(2R,3R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-11-hydroxy-2-methyl-1,4,7-trioxoundec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 6709219 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [(2R,3R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-11-hydroxy-2-methyl-1,4,7-trioxoundec-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)C=CC(=O)CCCCO)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO8/c1-16(22(33-17(2)27)21(29)12-11-20(28)10-6-7-13-26)23(30)25-19(15-32-24(25)31)14-18-8-4-3-5-9-18/h3-5,8-9,11-12,16,19,22,26H,6-7,10,13-15H2,1-2H3/t16-,19-,22-/m1/s1 |
| InChIKey | PYQWUOUTABBXLW-ZWDAVXSWSA-N |
| XLogP | 2.00 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|