About 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one
2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one (PubChem CID 3361757) has the molecular formula C16H24N2O3S
and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one.
Molecular Properties
| Compound Name | 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one |
| PubChem CID | 3361757 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one |
| SMILES | Cc1cc(C2SCCC(=O)N2CCN2CCOCC2)oc1C |
| InChI | InChI=1S/C16H24N2O3S/c1-12-11-14(21-13(12)2)16-18(15(19)3-10-22-16)5-4-17-6-8-20-9-7-17/h11,16H,3-10H2,1-2H3 |
| InChIKey | JNWXBBBKCSEOHJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one?
The IUPAC name of 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one (CID 3361757) is 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one.
What is the SMILES notation for 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one?
The canonical SMILES for 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one is Cc1cc(C2SCCC(=O)N2CCN2CCOCC2)oc1C.
What is the InChIKey of 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one?
The InChIKey is JNWXBBBKCSEOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3S/c1-12-11-14(21-13(12)2)16-18(15(19)3-10-22-16)5-4-17-6-8-20-9-7-17/h11,16H,3-10H2,1-2H3.
What are the key properties of 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one?
2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one has a molecular weight of 324.45 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylfuran-2-yl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one is sourced from PubChem (CID 3361757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).