C16H21ClN2O2S — CID 3771518
2-(2-chlorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one (PubChem CID 3771518) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one.
| Compound Name | 2-(2-chlorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3771518 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazinan-4-one |
| SMILES | O=C1CCSC(c2ccccc2Cl)N1CCN1CCOCC1 |
| InChI | InChI=1S/C16H21ClN2O2S/c17-14-4-2-1-3-13(14)16-19(15(20)5-12-22-16)7-6-18-8-10-21-11-9-18/h1-4,16H,5-12H2 |
| InChIKey | DYNZISXEHLEZGA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |