C14H20N2O2S2 — CID 4987991
3-(2-morpholin-4-ylethyl)-2-thiophen-3-yl-1,3-thiazinan-4-one (PubChem CID 4987991) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)-2-thiophen-3-yl-1,3-thiazinan-4-one.
| Compound Name | 3-(2-morpholin-4-ylethyl)-2-thiophen-3-yl-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 4987991 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)-2-thiophen-3-yl-1,3-thiazinan-4-one |
| SMILES | O=C1CCSC(c2ccsc2)N1CCN1CCOCC1 |
| InChI | InChI=1S/C14H20N2O2S2/c17-13-2-10-20-14(12-1-9-19-11-12)16(13)4-3-15-5-7-18-8-6-15/h1,9,11,14H,2-8,10H2 |
| InChIKey | CDZZAWMNJPIDEQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |