C18H17FN4O4 — CID 3362203
2-(4-fluorophenyl)-4-phenyldiazenyl-5-(1,2,3-trihydroxypropyl)-1H-pyrazol-3-one (PubChem CID 3362203) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-phenyldiazenyl-5-(1,2,3-trihydroxypropyl)-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-phenyldiazenyl-5-(1,2,3-trihydroxypropyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3362203 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(4-fluorophenyl)-4-phenyldiazenyl-5-(1,2,3-trihydroxypropyl)-1H-pyrazol-3-one |
| SMILES | O=c1c(/N=N/c2ccccc2)c(C(O)C(O)CO)[nH]n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O4/c19-11-6-8-13(9-7-11)23-18(27)16(15(22-23)17(26)14(25)10-24)21-20-12-4-2-1-3-5-12/h1-9,14,17,22,24-26H,10H2/b21-20+ |
| InChIKey | RIKQJCHWRPVLBB-QZQOTICOSA-N |
| XLogP | 2.11 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|