C49H51F2NO7 — CID 3366030
naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 3366030) has the molecular formula C49H51F2NO7 and a molecular weight of 803.94 g/mol. Its IUPAC name is naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 3366030 |
| Molecular Formula | C49H51F2NO7 |
| Molecular Weight | 803.94 g/mol |
| Exact Mass | 803.36 |
| IUPAC Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CN(CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(F)c(F)c4)CC(O)CCC(C)=CCCC32C)C(=O)Oc2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C49H51F2NO7/c1-31-8-7-22-48(2)42(40-19-12-32(24-37(53)16-11-31)25-41(40)46(54)35-15-20-43(50)44(51)27-35)21-23-49(48,56)30-52(29-36-14-17-38(57-3)28-45(36)58-4)47(55)59-39-18-13-33-9-5-6-10-34(33)26-39/h5-6,8-10,12-15,17-20,25-28,37,42,53,56H,7,11,16,21-24,29-30H2,1-4H3 |
| InChIKey | BWXYOKSOQXAKQS-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.94 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|