C26H25BrN4O6 — CID 3371502
N-(2-bromophenyl)-N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylpropanediamide (PubChem CID 3371502) has the molecular formula C26H25BrN4O6 and a molecular weight of 569.41 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylpropanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylpropanediamide |
|---|---|
| PubChem CID | 3371502 |
| Molecular Formula | C26H25BrN4O6 |
| Molecular Weight | 569.41 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | N-(2-bromophenyl)-N'-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylpropanediamide |
| SMILES | CCOc1cc(C=NNC(=O)C(C)C(=O)Nc2ccccc2Br)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25BrN4O6/c1-3-36-24-14-19(10-13-23(24)37-16-18-8-11-20(12-9-18)31(34)35)15-28-30-26(33)17(2)25(32)29-22-7-5-4-6-21(22)27/h4-15,17H,3,16H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | FQIGKIOVAQJATA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|