C21H29ClN4O6S — CID 3375020
tert-butyl N-[5-[5-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfonyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate (PubChem CID 3375020) has the molecular formula C21H29ClN4O6S and a molecular weight of 501.01 g/mol. Its IUPAC name is tert-butyl N-[5-[5-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfonyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfonyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 3375020 |
| Molecular Formula | C21H29ClN4O6S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | tert-butyl N-[5-[5-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfonyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
| SMILES | Cc1c(Cl)cccc1NC(=O)CS(=O)(=O)c1nnc(CCCCCNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C21H29ClN4O6S/c1-14-15(22)9-8-10-16(14)24-17(27)13-33(29,30)20-26-25-18(31-20)11-6-5-7-12-23-19(28)32-21(2,3)4/h8-10H,5-7,11-13H2,1-4H3,(H,23,28)(H,24,27) |
| InChIKey | MJVAIBSVSYOZEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|