C20H26ClN3O4S — CID 3787815
tert-butyl N-[5-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate (PubChem CID 3787815) has the molecular formula C20H26ClN3O4S and a molecular weight of 439.97 g/mol. Its IUPAC name is tert-butyl N-[5-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 3787815 |
| Molecular Formula | C20H26ClN3O4S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | tert-butyl N-[5-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCc1nnc(SCC(=O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H26ClN3O4S/c1-20(2,3)28-18(26)22-12-6-4-5-7-17-23-24-19(27-17)29-13-16(25)14-8-10-15(21)11-9-14/h8-11H,4-7,12-13H2,1-3H3,(H,22,26) |
| InChIKey | QKXFSBVDYMFFDY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|