C28H24N4O3 — CID 3377013
2-(1H-benzimidazol-2-yl)-N-(1,3-benzodioxol-5-ylmethyl)-3-(7-ethyl-1H-indol-3-yl)prop-2-enamide (PubChem CID 3377013) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-(1,3-benzodioxol-5-ylmethyl)-3-(7-ethyl-1H-indol-3-yl)prop-2-enamide.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-(1,3-benzodioxol-5-ylmethyl)-3-(7-ethyl-1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3377013 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-(1,3-benzodioxol-5-ylmethyl)-3-(7-ethyl-1H-indol-3-yl)prop-2-enamide |
| SMILES | CCc1cccc2c(C=C(C(=O)NCc3ccc4c(c3)OCO4)c3nc4ccccc4[nH]3)c[nH]c12 |
| InChI | InChI=1S/C28H24N4O3/c1-2-18-6-5-7-20-19(15-29-26(18)20)13-21(27-31-22-8-3-4-9-23(22)32-27)28(33)30-14-17-10-11-24-25(12-17)35-16-34-24/h3-13,15,29H,2,14,16H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | ZAHBBVYUHDFEHG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|