C15H25NO5 — CID 3385125
4-[4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoic acid (PubChem CID 3385125) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoic acid.
| Compound Name | 4-[4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 3385125 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoic acid |
| SMILES | CC(C)=CCCC1(C)OC(=O)N(CCCC(=O)O)C1(C)O |
| InChI | InChI=1S/C15H25NO5/c1-11(2)7-5-9-14(3)15(4,20)16(13(19)21-14)10-6-8-12(17)18/h7,20H,5-6,8-10H2,1-4H3,(H,17,18) |
| InChIKey | NSSGDDMZMSYFSP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|