C16H14Cl7NO4S — CID 3395119
N-(1-butoxy-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl)-4-chlorobenzenesulfonamide (PubChem CID 3395119) has the molecular formula C16H14Cl7NO4S and a molecular weight of 564.53 g/mol. Its IUPAC name is N-(1-butoxy-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(1-butoxy-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3395119 |
| Molecular Formula | C16H14Cl7NO4S |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 560.85 |
| IUPAC Name | N-(1-butoxy-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl)-4-chlorobenzenesulfonamide |
| SMILES | CCCCOC1(NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)=C(Cl)C(=O)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C16H14Cl7NO4S/c1-2-3-8-28-15(24-29(26,27)10-6-4-9(17)5-7-10)12(19)11(18)13(25)14(20,21)16(15,22)23/h4-7,24H,2-3,8H2,1H3 |
| InChIKey | QOQPMBXFHWQMJM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|