C22H24Cl2NO6PS — CID 3523795
4-chloro-N-(3-chloro-1-dipropoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide (PubChem CID 3523795) has the molecular formula C22H24Cl2NO6PS and a molecular weight of 532.38 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-1-dipropoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3-chloro-1-dipropoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3523795 |
| Molecular Formula | C22H24Cl2NO6PS |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 4-chloro-N-(3-chloro-1-dipropoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide |
| SMILES | CCCOP(=O)(OCCC)C1(NS(=O)(=O)c2ccc(Cl)cc2)C=C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24Cl2NO6PS/c1-3-13-30-32(27,31-14-4-2)22(25-33(28,29)17-11-9-16(23)10-12-17)15-20(24)21(26)18-7-5-6-8-19(18)22/h5-12,15,25H,3-4,13-14H2,1-2H3 |
| InChIKey | CMFVMTDTTIDLAN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|