C33H39ClNO8PS2 — CID 3526647
4-chloro-N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide (PubChem CID 3526647) has the molecular formula C33H39ClNO8PS2 and a molecular weight of 708.24 g/mol. Its IUPAC name is 4-chloro-N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3526647 |
| Molecular Formula | C33H39ClNO8PS2 |
| Molecular Weight | 708.24 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | 4-chloro-N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide |
| SMILES | CCCCCOP(=O)(OCCCCC)C1(NS(=O)(=O)c2ccc(Cl)cc2)C=C(S(=O)(=O)c2ccc(C)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C33H39ClNO8PS2/c1-4-6-10-22-42-44(37,43-23-11-7-5-2)33(35-46(40,41)28-20-16-26(34)17-21-28)24-31(32(36)29-12-8-9-13-30(29)33)45(38,39)27-18-14-25(3)15-19-27/h8-9,12-21,24,35H,4-7,10-11,22-23H2,1-3H3 |
| InChIKey | MGEBNCUDLBGTIF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.24 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|