C16H17Cl2NO4S — CID 1252458
N-(3,5-dichloro-1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)-4-methylbenzenesulfonamide (PubChem CID 1252458) has the molecular formula C16H17Cl2NO4S and a molecular weight of 390.29 g/mol. Its IUPAC name is N-(3,5-dichloro-1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3,5-dichloro-1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1252458 |
| Molecular Formula | C16H17Cl2NO4S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-(3,5-dichloro-1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)-4-methylbenzenesulfonamide |
| SMILES | COC1(NS(=O)(=O)c2ccc(C)cc2)C(C)=C(Cl)C(=O)C(Cl)=C1C |
| InChI | InChI=1S/C16H17Cl2NO4S/c1-9-5-7-12(8-6-9)24(21,22)19-16(23-4)10(2)13(17)15(20)14(18)11(16)3/h5-8,19H,1-4H3 |
| InChIKey | NIBGDJNSKMHWIX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|