C17H12Cl3NO4S — CID 3093672
4-chloro-N-(2,3-dichloro-1-methoxy-4-oxonaphthalen-1-yl)benzenesulfonamide (PubChem CID 3093672) has the molecular formula C17H12Cl3NO4S and a molecular weight of 432.71 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dichloro-1-methoxy-4-oxonaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,3-dichloro-1-methoxy-4-oxonaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3093672 |
| Molecular Formula | C17H12Cl3NO4S |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 4-chloro-N-(2,3-dichloro-1-methoxy-4-oxonaphthalen-1-yl)benzenesulfonamide |
| SMILES | COC1(NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)=C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H12Cl3NO4S/c1-25-17(21-26(23,24)11-8-6-10(18)7-9-11)13-5-3-2-4-12(13)15(22)14(19)16(17)20/h2-9,21H,1H3 |
| InChIKey | RAKFDXZOVBTBCF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|