C24H22NO8PS2 — CID 3502783
N-[3-(benzenesulfonyl)-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl]benzenesulfonamide (PubChem CID 3502783) has the molecular formula C24H22NO8PS2 and a molecular weight of 547.55 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl]benzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3502783 |
| Molecular Formula | C24H22NO8PS2 |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | N-[3-(benzenesulfonyl)-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl]benzenesulfonamide |
| SMILES | COP(=O)(OC)C1(NS(=O)(=O)c2ccccc2)C=C(S(=O)(=O)c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H22NO8PS2/c1-32-34(27,33-2)24(25-36(30,31)19-13-7-4-8-14-19)17-22(23(26)20-15-9-10-16-21(20)24)35(28,29)18-11-5-3-6-12-18/h3-17,25H,1-2H3 |
| InChIKey | AUZMZBXCWXNYJT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|