C28H30NO9PS2 — CID 3529077
N-[1-diethoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]-4-methoxybenzenesulfonamide (PubChem CID 3529077) has the molecular formula C28H30NO9PS2 and a molecular weight of 619.65 g/mol. Its IUPAC name is N-[1-diethoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[1-diethoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3529077 |
| Molecular Formula | C28H30NO9PS2 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | N-[1-diethoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]-4-methoxybenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C1(NS(=O)(=O)c2ccc(OC)cc2)C=C(S(=O)(=O)c2ccc(C)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H30NO9PS2/c1-5-37-39(31,38-6-2)28(29-41(34,35)23-17-13-21(36-4)14-18-23)19-26(27(30)24-9-7-8-10-25(24)28)40(32,33)22-15-11-20(3)12-16-22/h7-19,29H,5-6H2,1-4H3 |
| InChIKey | NHLQEZBDESPIDG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|