C33H40NO8PS2 — CID 3511080
N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide (PubChem CID 3511080) has the molecular formula C33H40NO8PS2 and a molecular weight of 673.79 g/mol. Its IUPAC name is N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide.
| Compound Name | N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3511080 |
| Molecular Formula | C33H40NO8PS2 |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.19 |
| IUPAC Name | N-[1-dipentoxyphosphoryl-3-(4-methylphenyl)sulfonyl-4-oxonaphthalen-1-yl]benzenesulfonamide |
| SMILES | CCCCCOP(=O)(OCCCCC)C1(NS(=O)(=O)c2ccccc2)C=C(S(=O)(=O)c2ccc(C)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C33H40NO8PS2/c1-4-6-13-23-41-43(36,42-24-14-7-5-2)33(34-45(39,40)28-15-9-8-10-16-28)25-31(32(35)29-17-11-12-18-30(29)33)44(37,38)27-21-19-26(3)20-22-27/h8-12,15-22,25,34H,4-7,13-14,23-24H2,1-3H3 |
| InChIKey | KTYQTOVZKKWDCE-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|