C19H13BrCl6N2O3S — CID 99657785
N-[(1R)-1-(4-bromoanilino)-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl]-4-methylbenzenesulfonamide (PubChem CID 99657785) has the molecular formula C19H13BrCl6N2O3S and a molecular weight of 642.01 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromoanilino)-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-bromoanilino)-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 99657785 |
| Molecular Formula | C19H13BrCl6N2O3S |
| Molecular Weight | 642.01 g/mol |
| Exact Mass | 637.80 |
| IUPAC Name | N-[(1R)-1-(4-bromoanilino)-2,3,5,5,6,6-hexachloro-4-oxocyclohex-2-en-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@]2(Nc3ccc(Br)cc3)C(Cl)=C(Cl)C(=O)C(Cl)(Cl)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H13BrCl6N2O3S/c1-10-2-8-13(9-3-10)32(30,31)28-18(27-12-6-4-11(20)5-7-12)15(22)14(21)16(29)17(23,24)19(18,25)26/h2-9,27-28H,1H3/t18-/m1/s1 |
| InChIKey | KTRDFSBJTBCQAG-GOSISDBHSA-N |
| XLogP | 6.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.01 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|