C25H17Cl8N3O4S2 — CID 99657768
4-chloro-N-[(1S)-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonylimino-1-(4-methylanilino)cyclohex-2-en-1-yl]benzenesulfonamide (PubChem CID 99657768) has the molecular formula C25H17Cl8N3O4S2 and a molecular weight of 771.19 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonylimino-1-(4-methylanilino)cyclohex-2-en-1-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1S)-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonylimino-1-(4-methylanilino)cyclohex-2-en-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 99657768 |
| Molecular Formula | C25H17Cl8N3O4S2 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 766.82 |
| IUPAC Name | 4-chloro-N-[(1S)-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonylimino-1-(4-methylanilino)cyclohex-2-en-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(N[C@]2(NS(=O)(=O)c3ccc(Cl)cc3)C(Cl)=C(Cl)C(=NS(=O)(=O)c3ccc(Cl)cc3)C(Cl)(Cl)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C25H17Cl8N3O4S2/c1-14-2-8-17(9-3-14)34-24(36-42(39,40)19-12-6-16(27)7-13-19)21(29)20(28)22(23(30,31)25(24,32)33)35-41(37,38)18-10-4-15(26)5-11-18/h2-13,34,36H,1H3/t24-/m0/s1 |
| InChIKey | XTVIQDKONOLNRA-DEOSSOPVSA-N |
| XLogP | 8.27 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|