C24H22N2O6 — CID 3396193
ethyl 4-[(2-oxochromene-3-carbonyl)-[(2-oxopyrrolidin-1-yl)methyl]amino]benzoate (PubChem CID 3396193) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 4-[(2-oxochromene-3-carbonyl)-[(2-oxopyrrolidin-1-yl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[(2-oxochromene-3-carbonyl)-[(2-oxopyrrolidin-1-yl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 3396193 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | ethyl 4-[(2-oxochromene-3-carbonyl)-[(2-oxopyrrolidin-1-yl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(CN2CCCC2=O)C(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C24H22N2O6/c1-2-31-23(29)16-9-11-18(12-10-16)26(15-25-13-5-8-21(25)27)22(28)19-14-17-6-3-4-7-20(17)32-24(19)30/h3-4,6-7,9-12,14H,2,5,8,13,15H2,1H3 |
| InChIKey | OYNWEAYVVNRUAP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|