C21H25N3O3S2 — CID 3398109
N'-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-5-thiophen-2-ylpentanehydrazide (PubChem CID 3398109) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N'-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-5-thiophen-2-ylpentanehydrazide.
| Compound Name | N'-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-5-thiophen-2-ylpentanehydrazide |
|---|---|
| PubChem CID | 3398109 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N'-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-5-thiophen-2-ylpentanehydrazide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NNC(=O)CCCCc3cccs3)cccc12 |
| InChI | InChI=1S/C21H25N3O3S2/c1-24(2)19-12-5-11-18-17(19)10-6-13-20(18)29(26,27)23-22-21(25)14-4-3-8-16-9-7-15-28-16/h5-7,9-13,15,23H,3-4,8,14H2,1-2H3,(H,22,25) |
| InChIKey | UYBGESWVJLINCP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|