C26H29FN2OS — CID 34064297
1-ethyl-3-(4-fluorophenyl)-1-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]thiourea (PubChem CID 34064297) has the molecular formula C26H29FN2OS and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-ethyl-3-(4-fluorophenyl)-1-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]thiourea.
| Compound Name | 1-ethyl-3-(4-fluorophenyl)-1-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 34064297 |
| Molecular Formula | C26H29FN2OS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-ethyl-3-(4-fluorophenyl)-1-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]thiourea |
| SMILES | CCN(C(=S)Nc1ccc(F)cc1)c1ccc(Oc2ccc(C(C)(C)CC)cc2)cc1 |
| InChI | InChI=1S/C26H29FN2OS/c1-5-26(3,4)19-7-15-23(16-8-19)30-24-17-13-22(14-18-24)29(6-2)25(31)28-21-11-9-20(27)10-12-21/h7-18H,5-6H2,1-4H3,(H,28,31) |
| InChIKey | UYQZAAXQIIVNAM-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|